Commissariat a L'energie Atomique

Jean-Claude Schulhof

Robert Teoule

Didier Molko

Andre Roget

The invention relates to derivatives of nucleosides and their use for the synthesis of oligonucleotides. These derivatives are in accordance with the formula: ##STR1## in which B represents a radical derived from guanine, cytosine or adenine, whose exocylic NH group is protected by the group ##STR2## with R.sup.1 representing a hydrogen atom or a alkyl radical and R.sup.2 a hydrogen atom, and alkyl radical, an alkoxy radical and optionally substituted aryloxy radical, R.sup.3 represents a hydrogen atom, the dimethoxytrityl radical or the radical ##STR3## R.sup.4 represents a hydrogen atom, the radical of formula: ##STR4## or a radical suitable for the synthesis of polynucelotides and R.sup.5 represents a hydrogen atom or the protected or unprotected hydroxyl OH radical.

Derivatives of nucleosides and their use for the synthesis of

N4-(3-phenylproprionyl)-2'-deoxycytidine derivatives are disclosed having the following formula: ##STR1## wherein R.sup.1 is --CO--CH.sub.2 --CH.sub.2 --C.sub.6 H.sub.5, R.sup.5 is hydrogen, a trityl group or the group --CO--CH.sub.2 --CH.sub.2 --C.sub.6 H.sub.5, R.sup.6 is selected from the group consisting of hydrogen, --CO--CH.sub.2 --CH.sub.2 --C.sub.6 H.sub.5, ##STR2## and R.sup.7 is hydrogen or OH. These derivatives are useful in oligonucleotide synthesis because the 3-phenyl-proprionyl blocking group can be removed rapidly by ammonia.

N4-(3-phenylproprionyl)-2'-deoxycytidine

The invention relates to derivatives of nucleosides and their use for the synthesis of oligonucleotides. These derivatives are in accordance with the formula: ##STR1## in which B represents a radical derived from guanine, cytosine or adenine, whose exocylic NH group is protected by the group ##STR2## with R.sup.1 representing a hydrogen atom or an alkyl radical and R.sup.2 a hydrogen atom, and alkyl radical, an alkoxy radical and optionally substituted aryloxy radical, R.sup.3 represents a hydrogen atom, the dimethoxytrityl radical or the radical ##STR3## R.sup.4 represents a hydrogen atom, the radical of formula: ##STR4## or a radical suitable for the synthesis of polynucleotides and R.sup.5 represents a hydrogen atom or the protected or unprotected hydroxyl OH radical.

Growing community of inventors

Saint Ismier, France

Jean-Claude Schulhof